C31H36N2O2 — CID 162391623
6-[2-[(1E,3E,5E,7Z)-7-(1-ethyl-3H-indol-2-ylidene)hepta-1,3,5-trienyl]-2,3-dihydroindol-1-yl]hexanoic acid (PubChem CID 162391623) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E,7Z)-7-(1-ethyl-3H-indol-2-ylidene)hepta-1,3,5-trienyl]-2,3-dihydroindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E,7Z)-7-(1-ethyl-3H-indol-2-ylidene)hepta-1,3,5-trienyl]-2,3-dihydroindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 162391623 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 6-[2-[(1E,3E,5E,7Z)-7-(1-ethyl-3H-indol-2-ylidene)hepta-1,3,5-trienyl]-2,3-dihydroindol-1-yl]hexanoic acid |
| SMILES | CCN1/C(=C\C=C\C=C\C=C\C2Cc3ccccc3N2CCCCCC(=O)O)Cc2ccccc21 |
| InChI | InChI=1S/C31H36N2O2/c1-2-32-27(23-25-15-10-12-19-29(25)32)17-7-4-3-5-8-18-28-24-26-16-11-13-20-30(26)33(28)22-14-6-9-21-31(34)35/h3-5,7-8,10-13,15-20,28H,2,6,9,14,21-24H2,1H3,(H,34,35)/b5-3+,7-4+,18-8+,27-17- |
| InChIKey | FKMWDYJFBUBKRR-STGCGTPISA-N |
| XLogP | 6.70 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|