C20H23FN2OS — CID 162391792
N'-[2-cyclopropyl-4-(2-fluorophenyl)sulfinyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 162391792) has the molecular formula C20H23FN2OS and a molecular weight of 358.48 g/mol. Its IUPAC name is N'-[2-cyclopropyl-4-(2-fluorophenyl)sulfinyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-cyclopropyl-4-(2-fluorophenyl)sulfinyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 162391792 |
| Molecular Formula | C20H23FN2OS |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-[2-cyclopropyl-4-(2-fluorophenyl)sulfinyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(S(=O)c2ccccc2F)cc1C1CC1 |
| InChI | InChI=1S/C20H23FN2OS/c1-4-23(3)13-22-18-11-14(2)20(12-16(18)15-9-10-15)25(24)19-8-6-5-7-17(19)21/h5-8,11-13,15H,4,9-10H2,1-3H3/b22-13+ |
| InChIKey | UAZJOWPPIITLKG-LPYMAVHISA-N |
| XLogP | 4.79 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|