C16H12F3N3O3 — CID 162392014
N-[(3-cyano-5-methoxyphenyl)methyl]-6-(difluoromethoxy)-5-fluoropyridine-3-carboxamide (PubChem CID 162392014) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[(3-cyano-5-methoxyphenyl)methyl]-6-(difluoromethoxy)-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[(3-cyano-5-methoxyphenyl)methyl]-6-(difluoromethoxy)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 162392014 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[(3-cyano-5-methoxyphenyl)methyl]-6-(difluoromethoxy)-5-fluoropyridine-3-carboxamide |
| SMILES | COc1cc(C#N)cc(CNC(=O)c2cnc(OC(F)F)c(F)c2)c1 |
| InChI | InChI=1S/C16H12F3N3O3/c1-24-12-3-9(6-20)2-10(4-12)7-21-14(23)11-5-13(17)15(22-8-11)25-16(18)19/h2-5,8,16H,7H2,1H3,(H,21,23) |
| InChIKey | GMVXGZIOPKVVQG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |