C10H9F5Si — CID 162392335
ethenyl-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 162392335) has the molecular formula C10H9F5Si and a molecular weight of 252.26 g/mol. Its IUPAC name is ethenyl-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | ethenyl-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 162392335 |
| Molecular Formula | C10H9F5Si |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | ethenyl-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C=C[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5Si/c1-4-16(2,3)10-8(14)6(12)5(11)7(13)9(10)15/h4H,1H2,2-3H3 |
| InChIKey | VUVXEUZUPCULCE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|