C20H38N2O2 — CID 162393250
1,4-dioctylpiperazine-2,3-dione (PubChem CID 162393250) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1,4-dioctylpiperazine-2,3-dione.
| Compound Name | 1,4-dioctylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 162393250 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | 1,4-dioctylpiperazine-2,3-dione |
| SMILES | CCCCCCCCN1CCN(CCCCCCCC)C(=O)C1=O |
| InChI | InChI=1S/C20H38N2O2/c1-3-5-7-9-11-13-15-21-17-18-22(20(24)19(21)23)16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| InChIKey | WSSVXSJTWBNUMD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|