C23H32O3 — CID 162393446
[(1S,2S,3R,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-[(E)-4-methylpent-2-enyl]benzoate (PubChem CID 162393446) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(1S,2S,3R,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-[(E)-4-methylpent-2-enyl]benzoate.
| Compound Name | [(1S,2S,3R,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-[(E)-4-methylpent-2-enyl]benzoate |
|---|---|
| PubChem CID | 162393446 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [(1S,2S,3R,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-[(E)-4-methylpent-2-enyl]benzoate |
| SMILES | CC(C)/C=C/Cc1ccc(C(=O)O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O)cc1 |
| InChI | InChI=1S/C23H32O3/c1-15(2)7-6-8-16-9-11-17(12-10-16)21(24)26-20-14-18-13-19(22(18,3)4)23(20,5)25/h6-7,9-12,15,18-20,25H,8,13-14H2,1-5H3/b7-6+/t18-,19-,20+,23-/m0/s1 |
| InChIKey | UPZFWCSYTAOLBB-DYCRDSNZSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|