About azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron
azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron (PubChem CID 162393569) has the molecular formula C5H15N2O4P
and a molecular weight of 198.16 g/mol. Its IUPAC name is azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron.
Molecular Properties
| Compound Name | azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron |
| PubChem CID | 162393569 |
| Molecular Formula | C5H15N2O4P |
| Molecular Weight | 198.16 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron |
| SMILES | CP(=O)([O-])CCC(N)C(=O)[O-].[H+].[NH4+] |
| InChI | InChI=1S/C5H12NO4P.H3N/c1-11(9,10)3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);1H3 |
| InChIKey | ZBMRKNMTMPPMMK-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.16 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron?
The IUPAC name of azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron (CID 162393569) is azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron.
What is the SMILES notation for azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron?
The canonical SMILES for azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron is CP(=O)([O-])CCC(N)C(=O)[O-].[H+].[NH4+].
What is the InChIKey of azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron?
The InChIKey is ZBMRKNMTMPPMMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12NO4P.H3N/c1-11(9,10)3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);1H3.
What are the key properties of azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron?
azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron has a molecular weight of 198.16 g/mol, XLogP of -1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;2-amino-4-[methyl(oxido)phosphoryl]butanoate;hydron is sourced from PubChem (CID 162393569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).