C40H42NO3PS — CID 162393922
N-[(S)-(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-(4-methoxyphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 162393922) has the molecular formula C40H42NO3PS and a molecular weight of 647.82 g/mol. Its IUPAC name is N-[(S)-(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-(4-methoxyphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | N-[(S)-(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-(4-methoxyphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162393922 |
| Molecular Formula | C40H42NO3PS |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | N-[(S)-(5-diphenylphosphanyl-9,9-dimethylxanthen-4-yl)-(4-methoxyphenyl)methyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | COc1ccc([C@@H](c2cccc3c2Oc2c(P(c4ccccc4)c4ccccc4)cccc2C3(C)C)N(C)S(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C40H42NO3PS/c1-39(2,3)46(42)41(6)36(28-24-26-29(43-7)27-25-28)32-20-14-21-33-37(32)44-38-34(40(33,4)5)22-15-23-35(38)45(30-16-10-8-11-17-30)31-18-12-9-13-19-31/h8-27,36H,1-7H3/t36-,46?/m0/s1 |
| InChIKey | GHNPMEYVIRKQLF-UAFXIGMRSA-N |
| XLogP | 8.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|