C14H16N8NaO4S3 — CID 162394266
CID 162394266 (PubChem CID 162394266) has the molecular formula C14H16N8NaO4S3 and a molecular weight of 479.53 g/mol.
| Compound Name | CID 162394266 |
|---|---|
| PubChem CID | 162394266 |
| Molecular Formula | C14H16N8NaO4S3 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | — |
| SMILES | Cc1nnc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)Cn4cnnn4)C3SC2)s1.[H][H].[Na] |
| InChI | InChI=1S/C14H14N8O4S3.Na.H2/c1-6-17-18-14(29-6)28-4-7-3-27-12-9(11(24)22(12)10(7)13(25)26)16-8(23)2-21-5-15-19-20-21;;/h5,9,12H,2-4H2,1H3,(H,16,23)(H,25,26);;1H |
| InChIKey | MTIAAUXSENDLGW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 156.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |