About [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone
[(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone (PubChem CID 162394456) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone |
| PubChem CID | 162394456 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone |
| SMILES | C[C@H]1C=CCCN1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O2/c1-10-4-2-3-5-13(10)11(14)12-6-8-15-9-7-12/h2,4,10H,3,5-9H2,1H3/t10-/m0/s1 |
| InChIKey | UMDVIWOAFDEGOC-JTQLQIEISA-N |
| XLogP | 1.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone?
The IUPAC name of [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone (CID 162394456) is [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone is C[C@H]1C=CCCN1C(=O)N1CCOCC1.
What is the InChIKey of [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone?
The InChIKey is UMDVIWOAFDEGOC-JTQLQIEISA-N. The full InChI is InChI=1S/C11H18N2O2/c1-10-4-2-3-5-13(10)11(14)12-6-8-15-9-7-12/h2,4,10H,3,5-9H2,1H3/t10-/m0/s1.
What are the key properties of [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone?
[(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone has a molecular weight of 210.28 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S)-6-methyl-3,6-dihydro-2H-pyridin-1-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 162394456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).