About bis(1,10-phenanthroline);platinum
bis(1,10-phenanthroline);platinum (PubChem CID 162394466) has the molecular formula C24H16N4Pt
and a molecular weight of 555.50 g/mol. Its IUPAC name is bis(1,10-phenanthroline);platinum.
Molecular Properties
| Compound Name | bis(1,10-phenanthroline);platinum |
| PubChem CID | 162394466 |
| Molecular Formula | C24H16N4Pt |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | bis(1,10-phenanthroline);platinum |
| SMILES | [Pt].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/2C12H8N2.Pt/c2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2*1-8H; |
| InChIKey | PMTHRTGZYZUPOQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(1,10-phenanthroline);platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,10-phenanthroline);platinum?
The IUPAC name of bis(1,10-phenanthroline);platinum (CID 162394466) is bis(1,10-phenanthroline);platinum.
What is the SMILES notation for bis(1,10-phenanthroline);platinum?
The canonical SMILES for bis(1,10-phenanthroline);platinum is [Pt].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of bis(1,10-phenanthroline);platinum?
The InChIKey is PMTHRTGZYZUPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8N2.Pt/c2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2*1-8H;.
What are the key properties of bis(1,10-phenanthroline);platinum?
bis(1,10-phenanthroline);platinum has a molecular weight of 555.50 g/mol, XLogP of 5.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,10-phenanthroline);platinum is sourced from PubChem (CID 162394466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).