C36H31N3O4S2 — CID 162394724
(5Z)-5-[[4-[2-(3-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]phenyl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 162394724) has the molecular formula C36H31N3O4S2 and a molecular weight of 633.80 g/mol. Its IUPAC name is (5Z)-5-[[4-[2-(3-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]phenyl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[2-(3-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]phenyl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162394724 |
| Molecular Formula | C36H31N3O4S2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | (5Z)-5-[[4-[2-(3-methoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]phenyl]methylidene]-3-[2-(4-methoxyphenyl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)/C(=C/c3ccc(C4Oc5ccccc5C5CC(c6cccc(OC)c6)=NN54)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C36H31N3O4S2/c1-41-27-16-12-23(13-17-27)18-19-38-34(40)33(45-36(38)44)20-24-10-14-25(15-11-24)35-39-31(29-8-3-4-9-32(29)43-35)22-30(37-39)26-6-5-7-28(21-26)42-2/h3-17,20-21,31,35H,18-19,22H2,1-2H3/b33-20- |
| InChIKey | YFCHCKNGQPMTME-UCMJSZAQSA-N |
| XLogP | 7.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|