C19H16ClNO4S2 — CID 162394725
2-[(5E)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid (PubChem CID 162394725) has the molecular formula C19H16ClNO4S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(5E)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 162394725 |
| Molecular Formula | C19H16ClNO4S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)/C(=C\c2ccc(-c3ccc(Cl)cc3)o2)SC1=S |
| InChI | InChI=1S/C19H16ClNO4S2/c1-10(2)16(18(23)24)21-17(22)15(27-19(21)26)9-13-7-8-14(25-13)11-3-5-12(20)6-4-11/h3-10,16H,1-2H3,(H,23,24)/b15-9+ |
| InChIKey | BAYWGPQNHHIYQI-OQLLNIDSSA-N |
| XLogP | 4.91 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|