C23H28N6O3S — CID 162394910
(11Z)-11-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione (PubChem CID 162394910) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is (11Z)-11-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione.
| Compound Name | (11Z)-11-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 162394910 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (11Z)-11-[1-(2,2-dimethylpropyl)-2-oxoindol-3-ylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
| SMILES | CCN1C(=O)N(CC)C2Nn3c(s/c(=C4\C(=O)N(CC(C)(C)C)c5ccccc54)c3=O)=NC21 |
| InChI | InChI=1S/C23H28N6O3S/c1-6-26-17-18(27(7-2)22(26)32)25-29-20(31)16(33-21(29)24-17)15-13-10-8-9-11-14(13)28(19(15)30)12-23(3,4)5/h8-11,17-18,25H,6-7,12H2,1-5H3/b16-15- |
| InChIKey | UIPWOLSUQCTYKX-NXVVXOECSA-N |
| XLogP | 1.11 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |