C37H28F3N5O5S — CID 162395165
2-[[3-nitro-4-(2-phenylethylamino)benzoyl]amino]-N-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 162395165) has the molecular formula C37H28F3N5O5S and a molecular weight of 711.72 g/mol. Its IUPAC name is 2-[[3-nitro-4-(2-phenylethylamino)benzoyl]amino]-N-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[[3-nitro-4-(2-phenylethylamino)benzoyl]amino]-N-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 162395165 |
| Molecular Formula | C37H28F3N5O5S |
| Molecular Weight | 711.72 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | 2-[[3-nitro-4-(2-phenylethylamino)benzoyl]amino]-N-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)c1ccc2nc(NC(=O)c3ccc(NCCc4ccccc4)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C37H28F3N5O5S/c38-37(39,40)27-10-6-24(7-11-27)22-50-29-14-12-28(13-15-29)42-34(46)26-9-17-31-33(21-26)51-36(43-31)44-35(47)25-8-16-30(32(20-25)45(48)49)41-19-18-23-4-2-1-3-5-23/h1-17,20-21,41H,18-19,22H2,(H,42,46)(H,43,44,47) |
| InChIKey | JYXHHMVLXXOQRE-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.72 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|