C34H47FN2S — CID 162395197
(1S,2R,13S,14S,17R,18R)-N-(2-fluorophenyl)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine (PubChem CID 162395197) has the molecular formula C34H47FN2S and a molecular weight of 534.83 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18R)-N-(2-fluorophenyl)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine.
| Compound Name | (1S,2R,13S,14S,17R,18R)-N-(2-fluorophenyl)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
|---|---|
| PubChem CID | 162395197 |
| Molecular Formula | C34H47FN2S |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | (1S,2R,13S,14S,17R,18R)-N-(2-fluorophenyl)-2,18-dimethyl-17-[(2R)-6-methylheptan-2-yl]-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4c5sc(Nc6ccccc6F)nc5CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H47FN2S/c1-21(2)9-8-10-22(3)24-15-16-25-23-13-14-27-31-30(18-20-34(27,5)26(23)17-19-33(24,25)4)37-32(38-31)36-29-12-7-6-11-28(29)35/h6-7,11-12,14,21-26H,8-10,13,15-20H2,1-5H3,(H,36,37)/t22-,23+,24-,25+,26+,33-,34-/m1/s1 |
| InChIKey | CMGGWTIGHQTEDI-YBHWBILDSA-N |
| XLogP | 10.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |