C20H30O2 — CID 162395332
(4aS,4bS,10aS)-7-(2-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one (PubChem CID 162395332) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4aS,4bS,10aS)-7-(2-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,4bS,10aS)-7-(2-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 162395332 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4aS,4bS,10aS)-7-(2-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,4b,5,6,10,10a-hexahydro-3H-phenanthren-2-one |
| SMILES | CC(C)(O)C1=CC2=CC[C@@H]3C(C)(C)C(=O)CC[C@@]3(C)[C@@H]2CC1 |
| InChI | InChI=1S/C20H30O2/c1-18(2)16-9-6-13-12-14(19(3,4)22)7-8-15(13)20(16,5)11-10-17(18)21/h6,12,15-16,22H,7-11H2,1-5H3/t15-,16-,20+/m1/s1 |
| InChIKey | DOMLIWYUYYSQBJ-QINHECLXSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |