C24H21FN6O3S — CID 162395336
N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 162395336) has the molecular formula C24H21FN6O3S and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162395336 |
| Molecular Formula | C24H21FN6O3S |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N-[2-[[4-[6-(3-fluorophenyl)imidazo[2,1-b][1,3]oxazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNc2nccc(-c3c(-c4cccc(F)c4)nc4occn34)n2)cc1 |
| InChI | InChI=1S/C24H21FN6O3S/c1-16-5-7-19(8-6-16)35(32,33)28-12-11-27-23-26-10-9-20(29-23)22-21(17-3-2-4-18(25)15-17)30-24-31(22)13-14-34-24/h2-10,13-15,28H,11-12H2,1H3,(H,26,27,29) |
| InChIKey | RJSUDQKPYMOISR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|