C24H19F3N6O3S — CID 162395501
N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]oxazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 162395501) has the molecular formula C24H19F3N6O3S and a molecular weight of 528.52 g/mol. Its IUPAC name is N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]oxazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]oxazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162395501 |
| Molecular Formula | C24H19F3N6O3S |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-[2-[[4-(6-phenylimidazo[2,1-b][1,3]oxazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1nccc(-c2c(-c3ccccc3)nc3occn23)n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H19F3N6O3S/c25-24(26,27)17-6-8-18(9-7-17)37(34,35)30-13-12-29-22-28-11-10-19(31-22)21-20(16-4-2-1-3-5-16)32-23-33(21)14-15-36-23/h1-11,14-15,30H,12-13H2,(H,28,29,31) |
| InChIKey | OCLFLGNPKMNRJD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|