C23H23Cl2N5O2 — CID 162395636
9-[4-[bis(2-chloroethyl)amino]phenyl]-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile (PubChem CID 162395636) has the molecular formula C23H23Cl2N5O2 and a molecular weight of 472.38 g/mol. Its IUPAC name is 9-[4-[bis(2-chloroethyl)amino]phenyl]-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile.
| Compound Name | 9-[4-[bis(2-chloroethyl)amino]phenyl]-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
|---|---|
| PubChem CID | 162395636 |
| Molecular Formula | C23H23Cl2N5O2 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 9-[4-[bis(2-chloroethyl)amino]phenyl]-12-imino-10,11-dioxatricyclo[5.3.2.01,6]dodecane-7,8,8-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCC2C1(C#N)C(C#N)(C#N)C(c1ccc(N(CCCl)CCCl)cc1)O3 |
| InChI | InChI=1S/C23H23Cl2N5O2/c24-9-11-30(12-10-25)17-6-4-16(5-7-17)19-21(13-26,14-27)22(15-28)18-3-1-2-8-23(18,31-19)32-20(22)29/h4-7,18-19,29H,1-3,8-12H2/b29-20+ |
| InChIKey | OITJPAOTYCGLFB-ZTKZIYFRSA-N |
| XLogP | 4.48 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|