About 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione
1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione (PubChem CID 162395729) has the molecular formula C15H10N4O3
and a molecular weight of 294.27 g/mol. Its IUPAC name is 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione.
Molecular Properties
| Compound Name | 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione |
| PubChem CID | 162395729 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2nc3cc(-c4ccccc4)oc3nc21 |
| InChI | InChI=1S/C15H10N4O3/c1-19-12-11(13(20)18-15(19)21)16-9-7-10(22-14(9)17-12)8-5-3-2-4-6-8/h2-7H,1H3,(H,18,20,21) |
| InChIKey | MIPFTQSJQSLUGA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione?
The IUPAC name of 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione (CID 162395729) is 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione.
What is the SMILES notation for 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione?
The canonical SMILES for 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione is Cn1c(=O)[nH]c(=O)c2nc3cc(-c4ccccc4)oc3nc21.
What is the InChIKey of 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione?
The InChIKey is MIPFTQSJQSLUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O3/c1-19-12-11(13(20)18-15(19)21)16-9-7-10(22-14(9)17-12)8-5-3-2-4-6-8/h2-7H,1H3,(H,18,20,21).
What are the key properties of 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione?
1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione has a molecular weight of 294.27 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-phenylfuro[3,2-g]pteridine-2,4-dione is sourced from PubChem (CID 162395729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).