C29H24Br3N3O2 — CID 162396357
2,2,2-tribromo-N-[(1R)-2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide (PubChem CID 162396357) has the molecular formula C29H24Br3N3O2 and a molecular weight of 686.24 g/mol. Its IUPAC name is 2,2,2-tribromo-N-[(1R)-2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide.
| Compound Name | 2,2,2-tribromo-N-[(1R)-2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 162396357 |
| Molecular Formula | C29H24Br3N3O2 |
| Molecular Weight | 686.24 g/mol |
| Exact Mass | 682.94 |
| IUPAC Name | 2,2,2-tribromo-N-[(1R)-2-oxo-2-[[(1S)-1-phenylethyl]amino]-1-pyridin-3-ylethyl]-N-(4-phenylphenyl)acetamide |
| SMILES | C[C@H](NC(=O)[C@@H](c1cccnc1)N(C(=O)C(Br)(Br)Br)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H24Br3N3O2/c1-20(21-9-4-2-5-10-21)34-27(36)26(24-13-8-18-33-19-24)35(28(37)29(30,31)32)25-16-14-23(15-17-25)22-11-6-3-7-12-22/h2-20,26H,1H3,(H,34,36)/t20-,26+/m0/s1 |
| InChIKey | MZBODFNXEFAFEI-RXFWQSSRSA-N |
| XLogP | 7.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.24 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|