C13H16F15NO3S — CID 162396483
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;triethylazanium (PubChem CID 162396483) has the molecular formula C13H16F15NO3S and a molecular weight of 551.31 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;triethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 162396483 |
| Molecular Formula | C13H16F15NO3S |
| Molecular Weight | 551.31 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF15O3S.C6H15N/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)26(23,24)25;1-4-7(5-2)6-3/h(H,23,24,25);4-6H2,1-3H3 |
| InChIKey | CQCBZJVAWAAGSD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|