C11H16F11NO3S — CID 162396538
triethylazanium;1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate (PubChem CID 162396538) has the molecular formula C11H16F11NO3S and a molecular weight of 451.30 g/mol. Its IUPAC name is triethylazanium;1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate.
| Compound Name | triethylazanium;1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 162396538 |
| Molecular Formula | C11H16F11NO3S |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | triethylazanium;1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane-1-sulfonate |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C5HF11O3S/c1-4-7(5-2)6-3;6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)20(17,18)19/h4-6H2,1-3H3;(H,17,18,19) |
| InChIKey | KWOCZGNQCCQHFZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|