C6H2F10O4 — CID 162396554
2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetic acid (PubChem CID 162396554) has the molecular formula C6H2F10O4 and a molecular weight of 328.06 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetic acid.
| Compound Name | 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetic acid |
|---|---|
| PubChem CID | 162396554 |
| Molecular Formula | C6H2F10O4 |
| Molecular Weight | 328.06 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-fluoro-2-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]acetic acid |
| SMILES | O=C(O)C(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C6H2F10O4/c7-1(2(17)18)19-4(10,11)3(8,9)5(12,13)20-6(14,15)16/h1H,(H,17,18) |
| InChIKey | NHXHIJIMSICWIR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|