C32H53F15O13Si — CID 162396566
tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane (PubChem CID 162396566) has the molecular formula C32H53F15O13Si and a molecular weight of 958.82 g/mol. Its IUPAC name is tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane.
| Compound Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane |
|---|---|
| PubChem CID | 162396566 |
| Molecular Formula | C32H53F15O13Si |
| Molecular Weight | 958.82 g/mol |
| Exact Mass | 958.30 |
| IUPAC Name | tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane |
| SMILES | COCCOCCOCCO[Si](CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCCOCCOCCOC)OCCOCCOCCOC |
| InChI | InChI=1S/C32H53F15O13Si/c1-48-6-9-51-12-15-54-18-21-58-61(59-22-19-55-16-13-52-10-7-49-2,60-23-20-56-17-14-53-11-8-50-3)24-4-5-57-25-26(33,34)27(35,36)28(37,38)29(39,40)30(41,42)31(43,44)32(45,46)47/h4-25H2,1-3H3 |
| InChIKey | OOEUAAUNUIPQFV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.82 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|