C7H3F11O4 — CID 162396578
2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]acetic acid (PubChem CID 162396578) has the molecular formula C7H3F11O4 and a molecular weight of 360.08 g/mol. Its IUPAC name is 2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]acetic acid.
| Compound Name | 2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 162396578 |
| Molecular Formula | C7H3F11O4 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]acetic acid |
| SMILES | O=C(O)COC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F11O4/c8-3(9,4(10,11)12)5(13,14)22-7(17,18)6(15,16)21-1-2(19)20/h1H2,(H,19,20) |
| InChIKey | QLRRNFFYOHDQOQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|