C14H16F15IN2O2 — CID 162396593
trimethyl-[3-[[2,2,3,3,4,4,5,5-octafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentanoyl]amino]propyl]azanium iodide (PubChem CID 162396593) has the molecular formula C14H16F15IN2O2 and a molecular weight of 656.17 g/mol. Its IUPAC name is trimethyl-[3-[[2,2,3,3,4,4,5,5-octafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentanoyl]amino]propyl]azanium iodide.
| Compound Name | trimethyl-[3-[[2,2,3,3,4,4,5,5-octafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentanoyl]amino]propyl]azanium iodide |
|---|---|
| PubChem CID | 162396593 |
| Molecular Formula | C14H16F15IN2O2 |
| Molecular Weight | 656.17 g/mol |
| Exact Mass | 656.00 |
| IUPAC Name | trimethyl-[3-[[2,2,3,3,4,4,5,5-octafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentanoyl]amino]propyl]azanium iodide |
| SMILES | C[N+](C)(C)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C14H15F15N2O2.HI/c1-31(2,3)6-4-5-30-7(32)8(15,16)9(17,18)10(19,20)14(28,29)33-11(21,12(22,23)24)13(25,26)27;/h4-6H2,1-3H3;1H |
| InChIKey | UAEWNJQUKMOMLV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|