C27H35F19O9 — CID 162396599
1,1,1,5,5,6,6,6-octafluoro-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-(1,1,2,2,2-pentafluoroethyl)-3,4-bis(trifluoromethyl)hex-2-ene (PubChem CID 162396599) has the molecular formula C27H35F19O9 and a molecular weight of 864.53 g/mol. Its IUPAC name is 1,1,1,5,5,6,6,6-octafluoro-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-(1,1,2,2,2-pentafluoroethyl)-3,4-bis(trifluoromethyl)hex-2-ene.
| Compound Name | 1,1,1,5,5,6,6,6-octafluoro-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-(1,1,2,2,2-pentafluoroethyl)-3,4-bis(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 162396599 |
| Molecular Formula | C27H35F19O9 |
| Molecular Weight | 864.53 g/mol |
| Exact Mass | 864.20 |
| IUPAC Name | 1,1,1,5,5,6,6,6-octafluoro-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-(1,1,2,2,2-pentafluoroethyl)-3,4-bis(trifluoromethyl)hex-2-ene |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOC(=C(C(F)(F)F)C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H35F19O9/c1-47-2-3-48-4-5-49-6-7-50-8-9-51-10-11-52-12-13-53-14-15-54-16-17-55-19(22(31,32)33)18(21(28,29)30)20(25(38,39)40,23(34,35)26(41,42)43)24(36,37)27(44,45)46/h2-17H2,1H3 |
| InChIKey | ULNRIBLDWVQOSM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.53 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|