C7F13NaO4S — CID 162396626
sodium 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfinate (PubChem CID 162396626) has the molecular formula C7F13NaO4S and a molecular weight of 450.10 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfinate.
| Compound Name | sodium 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfinate |
|---|---|
| PubChem CID | 162396626 |
| Molecular Formula | C7F13NaO4S |
| Molecular Weight | 450.10 g/mol |
| Exact Mass | 449.92 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)(OC(F)=C(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C7HF13O4S.Na/c8-1(9)2(10)23-3(11,4(12,13)14)5(15,16)24-6(17,18)7(19,20)25(21)22;/h(H,21,22);/q;+1/p-1 |
| InChIKey | ZDGDORSAGNVAOT-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.10 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|