C26H41F15O10Si — CID 162396630
tris[2-(2-methoxyethoxy)ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane (PubChem CID 162396630) has the molecular formula C26H41F15O10Si and a molecular weight of 826.66 g/mol. Its IUPAC name is tris[2-(2-methoxyethoxy)ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane.
| Compound Name | tris[2-(2-methoxyethoxy)ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane |
|---|---|
| PubChem CID | 162396630 |
| Molecular Formula | C26H41F15O10Si |
| Molecular Weight | 826.66 g/mol |
| Exact Mass | 826.22 |
| IUPAC Name | tris[2-(2-methoxyethoxy)ethoxy]-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)propyl]silane |
| SMILES | COCCOCCO[Si](CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCCOCCOC)OCCOCCOC |
| InChI | InChI=1S/C26H41F15O10Si/c1-42-6-9-45-12-15-49-52(50-16-13-46-10-7-43-2,51-17-14-47-11-8-44-3)18-4-5-48-19-20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)41/h4-19H2,1-3H3 |
| InChIKey | ZNSKRWKGYGQYOM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|