About benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate
benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate (PubChem CID 162396771) has the molecular formula C20H18ClN3O3S2
and a molecular weight of 447.97 g/mol. Its IUPAC name is benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate |
| PubChem CID | 162396771 |
| Molecular Formula | C20H18ClN3O3S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate |
| SMILES | CSc1nc(Cl)cc(CS(=O)(=NC(=O)OCc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H18ClN3O3S2/c1-28-19-22-16(12-18(21)23-19)14-29(26,17-10-6-3-7-11-17)24-20(25)27-13-15-8-4-2-5-9-15/h2-12H,13-14H2,1H3 |
| InChIKey | BIOZZAUGVNRSLW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate?
The IUPAC name of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate (CID 162396771) is benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate.
What is the SMILES notation for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate?
The canonical SMILES for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate is CSc1nc(Cl)cc(CS(=O)(=NC(=O)OCc2ccccc2)c2ccccc2)n1.
What is the InChIKey of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate?
The InChIKey is BIOZZAUGVNRSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O3S2/c1-28-19-22-16(12-18(21)23-19)14-29(26,17-10-6-3-7-11-17)24-20(25)27-13-15-8-4-2-5-9-15/h2-12H,13-14H2,1H3.
What are the key properties of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate?
benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate has a molecular weight of 447.97 g/mol, XLogP of 5.22, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-oxo-phenyl-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 162396771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).