About N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide
N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide (PubChem CID 162396778) has the molecular formula C11H14Cl2N2O2S
and a molecular weight of 309.22 g/mol. Its IUPAC name is N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide |
| PubChem CID | 162396778 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N[S@@](=O)Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c1-11(2,3)10(16)15-18(17)6-7-4-8(12)14-9(13)5-7/h4-5H,6H2,1-3H3,(H,15,16)/t18-/m0/s1 |
| InChIKey | UQZRFPBPVJKZMQ-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide (CID 162396778) is N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)N[S@@](=O)Cc1cc(Cl)nc(Cl)c1.
What is the InChIKey of N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide?
The InChIKey is UQZRFPBPVJKZMQ-SFHVURJKSA-N. The full InChI is InChI=1S/C11H14Cl2N2O2S/c1-11(2,3)10(16)15-18(17)6-7-4-8(12)14-9(13)5-7/h4-5H,6H2,1-3H3,(H,15,16)/t18-/m0/s1.
What are the key properties of N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide?
N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide has a molecular weight of 309.22 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(S)-(2,6-dichloro-4-pyridinyl)methylsulfinyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 162396778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).