About benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate
benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 162396807) has the molecular formula C15H16ClN3O3S2
and a molecular weight of 385.90 g/mol. Its IUPAC name is benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| PubChem CID | 162396807 |
| Molecular Formula | C15H16ClN3O3S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CSc1nc(Cl)cc(CS(C)(=O)=NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C15H16ClN3O3S2/c1-23-14-17-12(8-13(16)18-14)10-24(2,21)19-15(20)22-9-11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3 |
| InChIKey | OGKRHCZNMULWGY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate?
The IUPAC name of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate (CID 162396807) is benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
What is the SMILES notation for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate?
The canonical SMILES for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate is CSc1nc(Cl)cc(CS(C)(=O)=NC(=O)OCc2ccccc2)n1.
What is the InChIKey of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate?
The InChIKey is OGKRHCZNMULWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3O3S2/c1-23-14-17-12(8-13(16)18-14)10-24(2,21)19-15(20)22-9-11-6-4-3-5-7-11/h3-8H,9-10H2,1-2H3.
What are the key properties of benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate?
benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate has a molecular weight of 385.90 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)methyl-methyl-oxo-λ6-sulfanylidene]carbamate is sourced from PubChem (CID 162396807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).