About N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide
N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide (PubChem CID 162396810) has the molecular formula C12H17BrN2O2S
and a molecular weight of 333.25 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide |
| PubChem CID | 162396810 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N=[S@@](C)(=O)Cc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H17BrN2O2S/c1-12(2,3)11(16)15-18(4,17)8-10-6-5-9(13)7-14-10/h5-7H,8H2,1-4H3/t18-/m0/s1 |
| InChIKey | HVGXPNAYPLBHAH-SFHVURJKSA-N |
| XLogP | 3.01 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide?
The IUPAC name of N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide (CID 162396810) is N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide is CC(C)(C)C(=O)N=[S@@](C)(=O)Cc1ccc(Br)cn1.
What is the InChIKey of N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide?
The InChIKey is HVGXPNAYPLBHAH-SFHVURJKSA-N. The full InChI is InChI=1S/C12H17BrN2O2S/c1-12(2,3)11(16)15-18(4,17)8-10-6-5-9(13)7-14-10/h5-7H,8H2,1-4H3/t18-/m0/s1.
What are the key properties of N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide?
N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide has a molecular weight of 333.25 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-2-pyridinyl)methyl-methyl-oxo-λ6-sulfanylidene]-2,2-dimethylpropanamide is sourced from PubChem (CID 162396810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).