C16H20F5NO2S — CID 162396842
N-[tert-butyl-oxo-[(2,3,4,5,6-pentafluorophenyl)methyl]-λ6-sulfanylidene]-2,2-dimethylpropanamide (PubChem CID 162396842) has the molecular formula C16H20F5NO2S and a molecular weight of 385.40 g/mol. Its IUPAC name is N-[tert-butyl-oxo-[(2,3,4,5,6-pentafluorophenyl)methyl]-λ6-sulfanylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[tert-butyl-oxo-[(2,3,4,5,6-pentafluorophenyl)methyl]-λ6-sulfanylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 162396842 |
| Molecular Formula | C16H20F5NO2S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[tert-butyl-oxo-[(2,3,4,5,6-pentafluorophenyl)methyl]-λ6-sulfanylidene]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N=[S@@](=O)(Cc1c(F)c(F)c(F)c(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C16H20F5NO2S/c1-15(2,3)14(23)22-25(24,16(4,5)6)7-8-9(17)11(19)13(21)12(20)10(8)18/h7H2,1-6H3/t25-/m1/s1 |
| InChIKey | WCCTYYHZDQLFME-RUZDIDTESA-N |
| XLogP | 4.72 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|