C25H20N4O2 — CID 162396899
(4,7-dibenzyl-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl) acetate (PubChem CID 162396899) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is (4,7-dibenzyl-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl) acetate.
| Compound Name | (4,7-dibenzyl-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl) acetate |
|---|---|
| PubChem CID | 162396899 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (4,7-dibenzyl-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl) acetate |
| SMILES | CC(=O)Oc1c(Cc2ccccc2)nc2c(Cc3ccccc3)nc3cccnc3n12 |
| InChI | InChI=1S/C25H20N4O2/c1-17(30)31-25-22(16-19-11-6-3-7-12-19)28-24-21(15-18-9-4-2-5-10-18)27-20-13-8-14-26-23(20)29(24)25/h2-14H,15-16H2,1H3 |
| InChIKey | ZRECMFIAMCOBMV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |