C21H17F3O4 — CID 162396956
methyl 4-(3,3,3-trifluoro-2-hydroxy-2-naphthalen-2-ylpropoxy)benzoate (PubChem CID 162396956) has the molecular formula C21H17F3O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is methyl 4-(3,3,3-trifluoro-2-hydroxy-2-naphthalen-2-ylpropoxy)benzoate.
| Compound Name | methyl 4-(3,3,3-trifluoro-2-hydroxy-2-naphthalen-2-ylpropoxy)benzoate |
|---|---|
| PubChem CID | 162396956 |
| Molecular Formula | C21H17F3O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | methyl 4-(3,3,3-trifluoro-2-hydroxy-2-naphthalen-2-ylpropoxy)benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)(c2ccc3ccccc3c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F3O4/c1-27-19(25)15-7-10-18(11-8-15)28-13-20(26,21(22,23)24)17-9-6-14-4-2-3-5-16(14)12-17/h2-12,26H,13H2,1H3 |
| InChIKey | HQBUNIMPHAIDOM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |