C12H6ClF6NO — CID 162397073
4-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinoline (PubChem CID 162397073) has the molecular formula C12H6ClF6NO and a molecular weight of 329.63 g/mol. Its IUPAC name is 4-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinoline.
| Compound Name | 4-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinoline |
|---|---|
| PubChem CID | 162397073 |
| Molecular Formula | C12H6ClF6NO |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 4-chloro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)quinoline |
| SMILES | FC(F)(F)C(Oc1cc(Cl)c2ccccc2n1)C(F)(F)F |
| InChI | InChI=1S/C12H6ClF6NO/c13-7-5-9(20-8-4-2-1-3-6(7)8)21-10(11(14,15)16)12(17,18)19/h1-5,10H |
| InChIKey | SSMUIOHVHRYLRD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |