C21H28N2O7 — CID 162397095
diethyl 2-[6-(3,4-dimethoxyphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazol-5-yl]propanedioate (PubChem CID 162397095) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is diethyl 2-[6-(3,4-dimethoxyphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazol-5-yl]propanedioate.
| Compound Name | diethyl 2-[6-(3,4-dimethoxyphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazol-5-yl]propanedioate |
|---|---|
| PubChem CID | 162397095 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | diethyl 2-[6-(3,4-dimethoxyphenyl)-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazol-5-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1C(c2ccc(OC)c(OC)c2)CN2CCC(=O)N12 |
| InChI | InChI=1S/C21H28N2O7/c1-5-29-20(25)18(21(26)30-6-2)19-14(12-22-10-9-17(24)23(19)22)13-7-8-15(27-3)16(11-13)28-4/h7-8,11,14,18-19H,5-6,9-10,12H2,1-4H3 |
| InChIKey | OZXFWWIHBLDYCJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|