C14H18O5 — CID 162397142
(6R)-2-[(E)-hex-4-enoyl]-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one (PubChem CID 162397142) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (6R)-2-[(E)-hex-4-enoyl]-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one.
| Compound Name | (6R)-2-[(E)-hex-4-enoyl]-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162397142 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (6R)-2-[(E)-hex-4-enoyl]-3,5,6-trihydroxy-4,6-dimethylcyclohexa-2,4-dien-1-one |
| SMILES | C/C=C/CCC(=O)C1=C(O)C(C)=C(O)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C14H18O5/c1-4-5-6-7-9(15)10-11(16)8(2)12(17)14(3,19)13(10)18/h4-5,16-17,19H,6-7H2,1-3H3/b5-4+/t14-/m1/s1 |
| InChIKey | ZPEBLGAXWWYLTA-ISZGNANSSA-N |
| XLogP | 1.89 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|