C24H33NO6Si — CID 162397226
1-O-benzyl 2-O-methyl (2S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-1,2-dicarboxylate (PubChem CID 162397226) has the molecular formula C24H33NO6Si and a molecular weight of 459.62 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 162397226 |
| Molecular Formula | C24H33NO6Si |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-2,3,8,8a-tetrahydrooxepino[4,3-b]pyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC2=COC=CC(O[Si](C)(C)C(C)(C)C)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO6Si/c1-24(2,3)32(5,6)31-20-12-13-29-16-18-14-19(22(26)28-4)25(21(18)20)23(27)30-15-17-10-8-7-9-11-17/h7-13,16,19-21H,14-15H2,1-6H3/t19-,20?,21-/m0/s1 |
| InChIKey | FTOYNSXRWNODMK-YSTUSHMSSA-N |
| XLogP | 4.76 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|