C40H34F3N2O2+ — CID 162397272
4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol (PubChem CID 162397272) has the molecular formula C40H34F3N2O2+ and a molecular weight of 631.72 g/mol. Its IUPAC name is 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol.
| Compound Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol |
|---|---|
| PubChem CID | 162397272 |
| Molecular Formula | C40H34F3N2O2+ |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]quinolin-6-ol |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(F)c(F)c(F)c3)CC[C@H]1C[C@@H]2[C@@H](Oc1cc2ccccc2c2ccccc12)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C40H33F3N2O2/c1-2-25-23-45(22-24-17-34(41)39(43)35(42)18-24)16-14-26(25)19-37(45)40(32-13-15-44-36-12-11-28(46)21-33(32)36)47-38-20-27-7-3-4-8-29(27)30-9-5-6-10-31(30)38/h2-13,15,17-18,20-21,25-26,37,40H,1,14,16,19,22-23H2/p+1/t25-,26-,37+,40-,45+/m0/s1 |
| InChIKey | HWBNXDUBUBUONF-FSUKNUAOSA-O |
| XLogP | 9.40 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|