C41H36F3N2O2+ — CID 162397273
4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]-6-methoxyquinoline (PubChem CID 162397273) has the molecular formula C41H36F3N2O2+ and a molecular weight of 645.75 g/mol. Its IUPAC name is 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]-6-methoxyquinoline.
| Compound Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 162397273 |
| Molecular Formula | C41H36F3N2O2+ |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 4-[(S)-[(1S,2R,4S,5R)-5-ethenyl-1-[(3,4,5-trifluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-2-yl]-phenanthren-9-yloxymethyl]-6-methoxyquinoline |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(F)c(F)c(F)c3)CC[C@H]1C[C@@H]2[C@@H](Oc1cc2ccccc2c2ccccc12)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C41H36F3N2O2/c1-3-26-24-46(23-25-18-35(42)40(44)36(43)19-25)17-15-27(26)20-38(46)41(33-14-16-45-37-13-12-29(47-2)22-34(33)37)48-39-21-28-8-4-5-9-30(28)31-10-6-7-11-32(31)39/h3-14,16,18-19,21-22,26-27,38,41H,1,15,17,20,23-24H2,2H3/q+1/t26-,27-,38+,41-,46+/m0/s1 |
| InChIKey | PWYJICNLXGHYLG-FVKRUOBJSA-N |
| XLogP | 9.70 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|