C14H32OSi — CID 162397382
tert-butyl-[(2R,4R)-2,4-dimethylhexoxy]-dimethylsilane (PubChem CID 162397382) has the molecular formula C14H32OSi and a molecular weight of 244.49 g/mol. Its IUPAC name is tert-butyl-[(2R,4R)-2,4-dimethylhexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,4R)-2,4-dimethylhexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 162397382 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl-[(2R,4R)-2,4-dimethylhexoxy]-dimethylsilane |
| SMILES | CC[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32OSi/c1-9-12(2)10-13(3)11-15-16(7,8)14(4,5)6/h12-13H,9-11H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | CFNVEQIMGNVXGC-CHWSQXEVSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|