C16H21N5O4 — CID 162397415
4-morpholin-4-yl-6-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 162397415) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162397415 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-morpholin-4-yl-6-(3,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(-c2nc(N)nc(N3CCOCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C16H21N5O4/c1-22-11-8-10(9-12(23-2)13(11)24-3)14-18-15(17)20-16(19-14)21-4-6-25-7-5-21/h8-9H,4-7H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | YQTYUBMTIWAPQY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |