C14H13F13 — CID 162397468
9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluorotetradeca-6,7-diene (PubChem CID 162397468) has the molecular formula C14H13F13 and a molecular weight of 428.23 g/mol. Its IUPAC name is 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluorotetradeca-6,7-diene.
| Compound Name | 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluorotetradeca-6,7-diene |
|---|---|
| PubChem CID | 162397468 |
| Molecular Formula | C14H13F13 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluorotetradeca-6,7-diene |
| SMILES | CCCCCC=C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F13/c1-2-3-4-5-6-7-8-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h6,8H,2-5H2,1H3 |
| InChIKey | NFVQASOLEGNUOY-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|