About (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene
(3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene (PubChem CID 162397521) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene.
Molecular Properties
| Compound Name | (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene |
| PubChem CID | 162397521 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene |
| SMILES | C=C(COCC#CC)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C15H24O/c1-6-7-11-16-12-15(5)14(4)10-8-9-13(2)3/h9,14H,5,8,10-12H2,1-4H3/t14-/m1/s1 |
| InChIKey | HMQGANIVNVYFGN-CQSZACIVSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene?
The IUPAC name of (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene (CID 162397521) is (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene.
What is the SMILES notation for (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene?
The canonical SMILES for (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene is C=C(COCC#CC)[C@H](C)CCC=C(C)C.
What is the InChIKey of (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene?
The InChIKey is HMQGANIVNVYFGN-CQSZACIVSA-N. The full InChI is InChI=1S/C15H24O/c1-6-7-11-16-12-15(5)14(4)10-8-9-13(2)3/h9,14H,5,8,10-12H2,1-4H3/t14-/m1/s1.
What are the key properties of (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene?
(3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene has a molecular weight of 220.36 g/mol, XLogP of 3.96, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-(but-2-ynoxymethyl)-3,7-dimethylocta-1,6-diene is sourced from PubChem (CID 162397521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).