C22H33F6N3O — CID 162397644
(Z)-4-(butylamino)-5-[butyl-[1-butyl-5-(trifluoromethyl)pyrrol-3-yl]amino]-1,1,1-trifluoropent-3-en-2-one (PubChem CID 162397644) has the molecular formula C22H33F6N3O and a molecular weight of 469.51 g/mol. Its IUPAC name is (Z)-4-(butylamino)-5-[butyl-[1-butyl-5-(trifluoromethyl)pyrrol-3-yl]amino]-1,1,1-trifluoropent-3-en-2-one.
| Compound Name | (Z)-4-(butylamino)-5-[butyl-[1-butyl-5-(trifluoromethyl)pyrrol-3-yl]amino]-1,1,1-trifluoropent-3-en-2-one |
|---|---|
| PubChem CID | 162397644 |
| Molecular Formula | C22H33F6N3O |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | (Z)-4-(butylamino)-5-[butyl-[1-butyl-5-(trifluoromethyl)pyrrol-3-yl]amino]-1,1,1-trifluoropent-3-en-2-one |
| SMILES | CCCCN/C(=C\C(=O)C(F)(F)F)CN(CCCC)c1cc(C(F)(F)F)n(CCCC)c1 |
| InChI | InChI=1S/C22H33F6N3O/c1-4-7-10-29-17(13-20(32)22(26,27)28)15-30(11-8-5-2)18-14-19(21(23,24)25)31(16-18)12-9-6-3/h13-14,16,29H,4-12,15H2,1-3H3/b17-13- |
| InChIKey | SRMQJIHHFJAEFR-LGMDPLHJSA-N |
| XLogP | 6.32 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|