C15H24O5 — CID 162397645
[(2R,3R,5R)-2-ethyl-5-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]oxolan-3-yl] acetate (PubChem CID 162397645) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(2R,3R,5R)-2-ethyl-5-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-2-ethyl-5-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 162397645 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(2R,3R,5R)-2-ethyl-5-[(2S,4R,5S)-4-hydroxy-5-prop-2-enyloxolan-2-yl]oxolan-3-yl] acetate |
| SMILES | C=CC[C@@H]1O[C@H]([C@H]2C[C@@H](OC(C)=O)[C@@H](CC)O2)C[C@H]1O |
| InChI | InChI=1S/C15H24O5/c1-4-6-12-10(17)7-13(20-12)15-8-14(18-9(3)16)11(5-2)19-15/h4,10-15,17H,1,5-8H2,2-3H3/t10-,11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | ANMPEDYVZAXLQC-PEZGRIKUSA-N |
| XLogP | 1.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|